C18H14N2O — CID 172784232
2-isoquinolin-4-yl-3,4-dihydroisoquinolin-1-one (PubChem CID 172784232) has the molecular formula C18H14N2O and a molecular weight of 274.32 g/mol. Its IUPAC name is 2-isoquinolin-4-yl-3,4-dihydroisoquinolin-1-one.
| Compound Name | 2-isoquinolin-4-yl-3,4-dihydroisoquinolin-1-one |
|---|---|
| PubChem CID | 172784232 |
| Molecular Formula | C18H14N2O |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 2-isoquinolin-4-yl-3,4-dihydroisoquinolin-1-one |
| SMILES | O=C1c2ccccc2CCN1c1cncc2ccccc12 |
| InChI | InChI=1S/C18H14N2O/c21-18-16-8-4-1-5-13(16)9-10-20(18)17-12-19-11-14-6-2-3-7-15(14)17/h1-8,11-12H,9-10H2 |
| InChIKey | OQYMEDBKHYOOCM-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |