About 4-aminoadamantan-1-ol;5-chloro-1-cyclohexylpyrazole-4-carboxylic acid
4-aminoadamantan-1-ol;5-chloro-1-cyclohexylpyrazole-4-carboxylic acid (PubChem CID 172785552) has the molecular formula C20H30ClN3O3
and a molecular weight of 395.93 g/mol. Its IUPAC name is 4-aminoadamantan-1-ol;5-chloro-1-cyclohexylpyrazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 4-aminoadamantan-1-ol;5-chloro-1-cyclohexylpyrazole-4-carboxylic acid |
| PubChem CID | 172785552 |
| Molecular Formula | C20H30ClN3O3 |
| Molecular Weight | 395.93 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | 4-aminoadamantan-1-ol;5-chloro-1-cyclohexylpyrazole-4-carboxylic acid |
| SMILES | NC1C2CC3CC1CC(O)(C3)C2.O=C(O)c1cnn(C2CCCCC2)c1Cl |
| InChI | InChI=1S/C10H13ClN2O2.C10H17NO/c11-9-8(10(14)15)6-12-13(9)7-4-2-1-3-5-7;11-9-7-1-6-2-8(9)5-10(12,3-6)4-7/h6-7H,1-5H2,(H,14,15);6-9,12H,1-5,11H2 |
| InChIKey | OVOCWSBYSMGFBL-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.93 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-aminoadamantan-1-ol;5-chloro-1-cyclohexylpyrazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminoadamantan-1-ol;5-chloro-1-cyclohexylpyrazole-4-carboxylic acid?
The IUPAC name of 4-aminoadamantan-1-ol;5-chloro-1-cyclohexylpyrazole-4-carboxylic acid (CID 172785552) is 4-aminoadamantan-1-ol;5-chloro-1-cyclohexylpyrazole-4-carboxylic acid.
What is the SMILES notation for 4-aminoadamantan-1-ol;5-chloro-1-cyclohexylpyrazole-4-carboxylic acid?
The canonical SMILES for 4-aminoadamantan-1-ol;5-chloro-1-cyclohexylpyrazole-4-carboxylic acid is NC1C2CC3CC1CC(O)(C3)C2.O=C(O)c1cnn(C2CCCCC2)c1Cl.
What is the InChIKey of 4-aminoadamantan-1-ol;5-chloro-1-cyclohexylpyrazole-4-carboxylic acid?
The InChIKey is OVOCWSBYSMGFBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13ClN2O2.C10H17NO/c11-9-8(10(14)15)6-12-13(9)7-4-2-1-3-5-7;11-9-7-1-6-2-8(9)5-10(12,3-6)4-7/h6-7H,1-5H2,(H,14,15);6-9,12H,1-5,11H2.
What are the key properties of 4-aminoadamantan-1-ol;5-chloro-1-cyclohexylpyrazole-4-carboxylic acid?
4-aminoadamantan-1-ol;5-chloro-1-cyclohexylpyrazole-4-carboxylic acid has a molecular weight of 395.93 g/mol, XLogP of 3.62, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminoadamantan-1-ol;5-chloro-1-cyclohexylpyrazole-4-carboxylic acid is sourced from PubChem (CID 172785552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).