C20H31NO3 — CID 69160144
4-aminoadamantan-1-ol;5-hydroxyadamantan-2-one (PubChem CID 69160144) has the molecular formula C20H31NO3 and a molecular weight of 333.47 g/mol. Its IUPAC name is 4-aminoadamantan-1-ol;5-hydroxyadamantan-2-one.
| Compound Name | 4-aminoadamantan-1-ol;5-hydroxyadamantan-2-one |
|---|---|
| PubChem CID | 69160144 |
| Molecular Formula | C20H31NO3 |
| Molecular Weight | 333.47 g/mol |
| Exact Mass | 333.23 |
| IUPAC Name | 4-aminoadamantan-1-ol;5-hydroxyadamantan-2-one |
| SMILES | NC1C2CC3CC1CC(O)(C3)C2.O=C1C2CC3CC1CC(O)(C3)C2 |
| InChI | InChI=1S/C10H17NO.C10H14O2/c2*11-9-7-1-6-2-8(9)5-10(12,3-6)4-7/h6-9,12H,1-5,11H2;6-8,12H,1-5H2 |
| InChIKey | DZDBBLWNSVVJGQ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.47 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |