C22H31NO5 — CID 159203089
4-aminoadamantane-1-carboxylic acid;4-oxoadamantane-1-carboxylic acid (PubChem CID 159203089) has the molecular formula C22H31NO5 and a molecular weight of 389.49 g/mol. Its IUPAC name is 4-aminoadamantane-1-carboxylic acid;4-oxoadamantane-1-carboxylic acid.
| Compound Name | 4-aminoadamantane-1-carboxylic acid;4-oxoadamantane-1-carboxylic acid |
|---|---|
| PubChem CID | 159203089 |
| Molecular Formula | C22H31NO5 |
| Molecular Weight | 389.49 g/mol |
| Exact Mass | 389.22 |
| IUPAC Name | 4-aminoadamantane-1-carboxylic acid;4-oxoadamantane-1-carboxylic acid |
| SMILES | NC1C2CC3CC1CC(C(=O)O)(C3)C2.O=C1C2CC3CC1CC(C(=O)O)(C3)C2 |
| InChI | InChI=1S/C11H17NO2.C11H14O3/c2*12-9-7-1-6-2-8(9)5-11(3-6,4-7)10(13)14/h6-9H,1-5,12H2,(H,13,14);6-8H,1-5H2,(H,13,14) |
| InChIKey | KPNOFGWIYKSDRF-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.49 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |