C15H22N2O3 — CID 123182855
(3S)-4-(3,3-dimethyl-4-oxodiazetidin-1-yl)adamantane-1-carboxylic acid (PubChem CID 123182855) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is (3S)-4-(3,3-dimethyl-4-oxodiazetidin-1-yl)adamantane-1-carboxylic acid.
| Compound Name | (3S)-4-(3,3-dimethyl-4-oxodiazetidin-1-yl)adamantane-1-carboxylic acid |
|---|---|
| PubChem CID | 123182855 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | (3S)-4-(3,3-dimethyl-4-oxodiazetidin-1-yl)adamantane-1-carboxylic acid |
| SMILES | CC1(C)NN(C2C3CC4C[C@H]2CC(C(=O)O)(C4)C3)C1=O |
| InChI | InChI=1S/C15H22N2O3/c1-14(2)12(18)17(16-14)11-9-3-8-4-10(11)7-15(5-8,6-9)13(19)20/h8-11,16H,3-7H2,1-2H3,(H,19,20)/t8?,9-,10?,11?,15?/m0/s1 |
| InChIKey | PZGMJXIRZNJMBK-SEJPTUFMSA-N |
| XLogP | 1.39 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |