C25H28N2O3 — CID 46184591
(3S)-4-(3,3-dimethyl-2-oxo-4-quinolin-5-ylazetidin-1-yl)adamantane-1-carboxylic acid (PubChem CID 46184591) has the molecular formula C25H28N2O3 and a molecular weight of 404.51 g/mol. Its IUPAC name is (3S)-4-(3,3-dimethyl-2-oxo-4-quinolin-5-ylazetidin-1-yl)adamantane-1-carboxylic acid.
| Compound Name | (3S)-4-(3,3-dimethyl-2-oxo-4-quinolin-5-ylazetidin-1-yl)adamantane-1-carboxylic acid |
|---|---|
| PubChem CID | 46184591 |
| Molecular Formula | C25H28N2O3 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | (3S)-4-(3,3-dimethyl-2-oxo-4-quinolin-5-ylazetidin-1-yl)adamantane-1-carboxylic acid |
| SMILES | CC1(C)C(=O)N(C2C3CC4C[C@H]2CC(C(=O)O)(C4)C3)C1c1cccc2ncccc12 |
| InChI | InChI=1S/C25H28N2O3/c1-24(2)21(18-5-3-7-19-17(18)6-4-8-26-19)27(22(24)28)20-15-9-14-10-16(20)13-25(11-14,12-15)23(29)30/h3-8,14-16,20-21H,9-13H2,1-2H3,(H,29,30)/t14?,15-,16?,20?,21?,25?/m0/s1 |
| InChIKey | ISNOTAKYTBOUFA-SCRCHYRPSA-N |
| XLogP | 4.42 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |