C13H10N2O2S — CID 174351895
3-methyl-5-quinolin-5-yl-1,3-thiazolidine-2,4-dione (PubChem CID 174351895) has the molecular formula C13H10N2O2S and a molecular weight of 258.30 g/mol. Its IUPAC name is 3-methyl-5-quinolin-5-yl-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-methyl-5-quinolin-5-yl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 174351895 |
| Molecular Formula | C13H10N2O2S |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | 3-methyl-5-quinolin-5-yl-1,3-thiazolidine-2,4-dione |
| SMILES | CN1C(=O)SC(c2cccc3ncccc23)C1=O |
| InChI | InChI=1S/C13H10N2O2S/c1-15-12(16)11(18-13(15)17)9-4-2-6-10-8(9)5-3-7-14-10/h2-7,11H,1H3 |
| InChIKey | LEOULTGUDGJEOK-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|