About CID 172790192
CID 172790192 (PubChem CID 172790192) has the molecular formula C6H7NNaO
and a molecular weight of 132.12 g/mol.
Molecular Properties
| Compound Name | CID 172790192 |
| PubChem CID | 172790192 |
| Molecular Formula | C6H7NNaO |
| Molecular Weight | 132.12 g/mol |
| Exact Mass | 132.04 |
| IUPAC Name | — |
| SMILES | O=C1C[C@H]2CC=CN12.[Na] |
| InChI | InChI=1S/C6H7NO.Na/c8-6-4-5-2-1-3-7(5)6;/h1,3,5H,2,4H2;/t5-;/m1./s1 |
| InChIKey | PLQZQEVQLGHUET-NUBCRITNSA-N |
| XLogP | 0.12 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.12 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 172790192 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 172790192?
The IUPAC name of CID 172790192 (CID 172790192) is not available.
What is the SMILES notation for CID 172790192?
The canonical SMILES for CID 172790192 is O=C1C[C@H]2CC=CN12.[Na].
What is the InChIKey of CID 172790192?
The InChIKey is PLQZQEVQLGHUET-NUBCRITNSA-N. The full InChI is InChI=1S/C6H7NO.Na/c8-6-4-5-2-1-3-7(5)6;/h1,3,5H,2,4H2;/t5-;/m1./s1.
What are the key properties of CID 172790192?
CID 172790192 has a molecular weight of 132.12 g/mol, XLogP of 0.12, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 172790192 is sourced from PubChem (CID 172790192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).