C26H28ClN5O — CID 172790439
1-[4-[(5-chloro-2-pyridinyl)amino]-2-methylphenyl]piperidin-4-one;1H-indol-5-ylmethanamine (PubChem CID 172790439) has the molecular formula C26H28ClN5O and a molecular weight of 462.00 g/mol. Its IUPAC name is 1-[4-[(5-chloro-2-pyridinyl)amino]-2-methylphenyl]piperidin-4-one;1H-indol-5-ylmethanamine.
| Compound Name | 1-[4-[(5-chloro-2-pyridinyl)amino]-2-methylphenyl]piperidin-4-one;1H-indol-5-ylmethanamine |
|---|---|
| PubChem CID | 172790439 |
| Molecular Formula | C26H28ClN5O |
| Molecular Weight | 462.00 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | 1-[4-[(5-chloro-2-pyridinyl)amino]-2-methylphenyl]piperidin-4-one;1H-indol-5-ylmethanamine |
| SMILES | Cc1cc(Nc2ccc(Cl)cn2)ccc1N1CCC(=O)CC1.NCc1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C17H18ClN3O.C9H10N2/c1-12-10-14(20-17-5-2-13(18)11-19-17)3-4-16(12)21-8-6-15(22)7-9-21;10-6-7-1-2-9-8(5-7)3-4-11-9/h2-5,10-11H,6-9H2,1H3,(H,19,20);1-5,11H,6,10H2 |
| InChIKey | PMNJWLXDUFVWFE-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.00 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|