C23H23F2N3O — CID 70267621
5-(3,4-difluorophenoxy)-N-(3-methyl-4-piperidin-1-ylphenyl)pyridin-2-amine (PubChem CID 70267621) has the molecular formula C23H23F2N3O and a molecular weight of 395.45 g/mol. Its IUPAC name is 5-(3,4-difluorophenoxy)-N-(3-methyl-4-piperidin-1-ylphenyl)pyridin-2-amine.
| Compound Name | 5-(3,4-difluorophenoxy)-N-(3-methyl-4-piperidin-1-ylphenyl)pyridin-2-amine |
|---|---|
| PubChem CID | 70267621 |
| Molecular Formula | C23H23F2N3O |
| Molecular Weight | 395.45 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | 5-(3,4-difluorophenoxy)-N-(3-methyl-4-piperidin-1-ylphenyl)pyridin-2-amine |
| SMILES | Cc1cc(Nc2ccc(Oc3ccc(F)c(F)c3)cn2)ccc1N1CCCCC1 |
| InChI | InChI=1S/C23H23F2N3O/c1-16-13-17(5-9-22(16)28-11-3-2-4-12-28)27-23-10-7-19(15-26-23)29-18-6-8-20(24)21(25)14-18/h5-10,13-15H,2-4,11-12H2,1H3,(H,26,27) |
| InChIKey | ZWFBLZCPDORAQW-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.45 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|