C17H11F3N2O — CID 59588914
N-(3,4-difluorophenyl)-5-(4-fluorophenoxy)pyridin-2-amine (PubChem CID 59588914) has the molecular formula C17H11F3N2O and a molecular weight of 316.28 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-5-(4-fluorophenoxy)pyridin-2-amine.
| Compound Name | N-(3,4-difluorophenyl)-5-(4-fluorophenoxy)pyridin-2-amine |
|---|---|
| PubChem CID | 59588914 |
| Molecular Formula | C17H11F3N2O |
| Molecular Weight | 316.28 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | N-(3,4-difluorophenyl)-5-(4-fluorophenoxy)pyridin-2-amine |
| SMILES | Fc1ccc(Oc2ccc(Nc3ccc(F)c(F)c3)nc2)cc1 |
| InChI | InChI=1S/C17H11F3N2O/c18-11-1-4-13(5-2-11)23-14-6-8-17(21-10-14)22-12-3-7-15(19)16(20)9-12/h1-10H,(H,21,22) |
| InChIKey | PLRWUZFGTHQOQX-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.28 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |