C22H16O8 — CID 172792382
5-(3-carboxy-4-phenylphenyl)cyclohexa-3,5-diene-1,1,3-tricarboxylic acid (PubChem CID 172792382) has the molecular formula C22H16O8 and a molecular weight of 408.36 g/mol. Its IUPAC name is 5-(3-carboxy-4-phenylphenyl)cyclohexa-3,5-diene-1,1,3-tricarboxylic acid.
| Compound Name | 5-(3-carboxy-4-phenylphenyl)cyclohexa-3,5-diene-1,1,3-tricarboxylic acid |
|---|---|
| PubChem CID | 172792382 |
| Molecular Formula | C22H16O8 |
| Molecular Weight | 408.36 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | 5-(3-carboxy-4-phenylphenyl)cyclohexa-3,5-diene-1,1,3-tricarboxylic acid |
| SMILES | O=C(O)C1=CC(c2ccc(-c3ccccc3)c(C(=O)O)c2)=CC(C(=O)O)(C(=O)O)C1 |
| InChI | InChI=1S/C22H16O8/c23-18(24)15-8-14(10-22(11-15,20(27)28)21(29)30)13-6-7-16(17(9-13)19(25)26)12-4-2-1-3-5-12/h1-10H,11H2,(H,23,24)(H,25,26)(H,27,28)(H,29,30) |
| InChIKey | PTADAYKPYATGSW-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.36 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|