C54H48N2O2Si2 — CID 172792471
CID 172792471 (PubChem CID 172792471) has the molecular formula C54H48N2O2Si2 and a molecular weight of 813.16 g/mol.
| Compound Name | CID 172792471 |
|---|---|
| PubChem CID | 172792471 |
| Molecular Formula | C54H48N2O2Si2 |
| Molecular Weight | 813.16 g/mol |
| Exact Mass | 812.33 |
| IUPAC Name | — |
| SMILES | Oc1c(CN[C@H](c2ccccc2)[C@H](NCc2cccc([Si]C(c3ccccc3)c3ccccc3)c2O)c2ccccc2)cccc1[Si]C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C54H48N2O2Si2/c57-51-45(33-19-35-47(51)59-53(41-25-11-3-12-26-41)42-27-13-4-14-28-42)37-55-49(39-21-7-1-8-22-39)50(40-23-9-2-10-24-40)56-38-46-34-20-36-48(52(46)58)60-54(43-29-15-5-16-30-43)44-31-17-6-18-32-44/h1-36,49-50,53-58H,37-38H2/t49-,50-/m1/s1 |
| InChIKey | BIXUCDQXNQBWCN-CDKYPKJRSA-N |
| XLogP | 9.70 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 813.16 |
| LogP ≤ 5 | 9.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|