C54H52N2O2Si2 — CID 54159323
2-[[[(1R,2R)-2-[[2-hydroxy-3-[methyl(diphenyl)silyl]phenyl]methylamino]-1,2-diphenylethyl]amino]methyl]-6-[methyl(diphenyl)silyl]phenol (PubChem CID 54159323) has the molecular formula C54H52N2O2Si2 and a molecular weight of 817.19 g/mol. Its IUPAC name is 2-[[[(1R,2R)-2-[[2-hydroxy-3-[methyl(diphenyl)silyl]phenyl]methylamino]-1,2-diphenylethyl]amino]methyl]-6-[methyl(diphenyl)silyl]phenol.
| Compound Name | 2-[[[(1R,2R)-2-[[2-hydroxy-3-[methyl(diphenyl)silyl]phenyl]methylamino]-1,2-diphenylethyl]amino]methyl]-6-[methyl(diphenyl)silyl]phenol |
|---|---|
| PubChem CID | 54159323 |
| Molecular Formula | C54H52N2O2Si2 |
| Molecular Weight | 817.19 g/mol |
| Exact Mass | 816.36 |
| IUPAC Name | 2-[[[(1R,2R)-2-[[2-hydroxy-3-[methyl(diphenyl)silyl]phenyl]methylamino]-1,2-diphenylethyl]amino]methyl]-6-[methyl(diphenyl)silyl]phenol |
| SMILES | C[Si](c1ccccc1)(c1ccccc1)c1cccc(CN[C@H](c2ccccc2)[C@H](NCc2cccc([Si](C)(c3ccccc3)c3ccccc3)c2O)c2ccccc2)c1O |
| InChI | InChI=1S/C54H52N2O2Si2/c1-59(45-29-13-5-14-30-45,46-31-15-6-16-32-46)49-37-21-27-43(53(49)57)39-55-51(41-23-9-3-10-24-41)52(42-25-11-4-12-26-42)56-40-44-28-22-38-50(54(44)58)60(2,47-33-17-7-18-34-47)48-35-19-8-20-36-48/h3-38,51-52,55-58H,39-40H2,1-2H3/t51-,52-/m1/s1 |
| InChIKey | ONHRUIIIACXEGE-YWSWRHJRSA-N |
| XLogP | 7.66 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.19 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|