C28H34O6 — CID 172792943
3,4-bis[2-[4-(2-hydroxyethoxy)phenyl]propyl]benzene-1,2-diol (PubChem CID 172792943) has the molecular formula C28H34O6 and a molecular weight of 466.57 g/mol. Its IUPAC name is 3,4-bis[2-[4-(2-hydroxyethoxy)phenyl]propyl]benzene-1,2-diol.
| Compound Name | 3,4-bis[2-[4-(2-hydroxyethoxy)phenyl]propyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 172792943 |
| Molecular Formula | C28H34O6 |
| Molecular Weight | 466.57 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | 3,4-bis[2-[4-(2-hydroxyethoxy)phenyl]propyl]benzene-1,2-diol |
| SMILES | CC(Cc1ccc(O)c(O)c1CC(C)c1ccc(OCCO)cc1)c1ccc(OCCO)cc1 |
| InChI | InChI=1S/C28H34O6/c1-19(21-3-8-24(9-4-21)33-15-13-29)17-23-7-12-27(31)28(32)26(23)18-20(2)22-5-10-25(11-6-22)34-16-14-30/h3-12,19-20,29-32H,13-18H2,1-2H3 |
| InChIKey | PUZHLFVTCIVCLR-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.57 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|