About 2-hydroxyethylazanium;trimethylazanium;dichloride
2-hydroxyethylazanium;trimethylazanium;dichloride (PubChem CID 172796747) has the molecular formula C5H18Cl2N2O
and a molecular weight of 193.12 g/mol. Its IUPAC name is 2-hydroxyethylazanium;trimethylazanium;dichloride.
Molecular Properties
| Compound Name | 2-hydroxyethylazanium;trimethylazanium;dichloride |
| PubChem CID | 172796747 |
| Molecular Formula | C5H18Cl2N2O |
| Molecular Weight | 193.12 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | 2-hydroxyethylazanium;trimethylazanium;dichloride |
| SMILES | C[NH+](C)C.[Cl-].[Cl-].[NH3+]CCO |
| InChI | InChI=1S/C3H9N.C2H7NO.2ClH/c1-4(2)3;3-1-2-4;;/h1-3H3;4H,1-3H2;2*1H |
| InChIKey | QHPFCLQBWUGRQT-UHFFFAOYSA-N |
| XLogP | -9.01 |
| TPSA | 52.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.12 |
| LogP ≤ 5 | -9.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-hydroxyethylazanium;trimethylazanium;dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyethylazanium;trimethylazanium;dichloride?
The IUPAC name of 2-hydroxyethylazanium;trimethylazanium;dichloride (CID 172796747) is 2-hydroxyethylazanium;trimethylazanium;dichloride.
What is the SMILES notation for 2-hydroxyethylazanium;trimethylazanium;dichloride?
The canonical SMILES for 2-hydroxyethylazanium;trimethylazanium;dichloride is C[NH+](C)C.[Cl-].[Cl-].[NH3+]CCO.
What is the InChIKey of 2-hydroxyethylazanium;trimethylazanium;dichloride?
The InChIKey is QHPFCLQBWUGRQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9N.C2H7NO.2ClH/c1-4(2)3;3-1-2-4;;/h1-3H3;4H,1-3H2;2*1H.
What are the key properties of 2-hydroxyethylazanium;trimethylazanium;dichloride?
2-hydroxyethylazanium;trimethylazanium;dichloride has a molecular weight of 193.12 g/mol, XLogP of -9.01, 1 rotatable bonds, 3 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyethylazanium;trimethylazanium;dichloride is sourced from PubChem (CID 172796747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).