About ethylazanium;trimethylazanium;diiodide
ethylazanium;trimethylazanium;diiodide (PubChem CID 172824099) has the molecular formula C5H18I2N2
and a molecular weight of 360.02 g/mol. Its IUPAC name is ethylazanium;trimethylazanium;diiodide.
Molecular Properties
| Compound Name | ethylazanium;trimethylazanium;diiodide |
| PubChem CID | 172824099 |
| Molecular Formula | C5H18I2N2 |
| Molecular Weight | 360.02 g/mol |
| Exact Mass | 359.96 |
| IUPAC Name | ethylazanium;trimethylazanium;diiodide |
| SMILES | CC[NH3+].C[NH+](C)C.[I-].[I-] |
| InChI | InChI=1S/C3H9N.C2H7N.2HI/c1-4(2)3;1-2-3;;/h1-3H3;2-3H2,1H3;2*1H |
| InChIKey | UPWCOFVYMKMCOZ-UHFFFAOYSA-N |
| XLogP | -7.98 |
| TPSA | 32.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.02 |
| LogP ≤ 5 | -7.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze ethylazanium;trimethylazanium;diiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethylazanium;trimethylazanium;diiodide?
The IUPAC name of ethylazanium;trimethylazanium;diiodide (CID 172824099) is ethylazanium;trimethylazanium;diiodide.
What is the SMILES notation for ethylazanium;trimethylazanium;diiodide?
The canonical SMILES for ethylazanium;trimethylazanium;diiodide is CC[NH3+].C[NH+](C)C.[I-].[I-].
What is the InChIKey of ethylazanium;trimethylazanium;diiodide?
The InChIKey is UPWCOFVYMKMCOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9N.C2H7N.2HI/c1-4(2)3;1-2-3;;/h1-3H3;2-3H2,1H3;2*1H.
What are the key properties of ethylazanium;trimethylazanium;diiodide?
ethylazanium;trimethylazanium;diiodide has a molecular weight of 360.02 g/mol, XLogP of -7.98, 0 rotatable bonds, 2 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethylazanium;trimethylazanium;diiodide is sourced from PubChem (CID 172824099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).