C12H19ClNO4P — CID 172798184
[(4-tert-butyl-2-chlorophenyl)methyl-methoxyamino]phosphonic acid (PubChem CID 172798184) has the molecular formula C12H19ClNO4P and a molecular weight of 307.71 g/mol. Its IUPAC name is [(4-tert-butyl-2-chlorophenyl)methyl-methoxyamino]phosphonic acid.
| Compound Name | [(4-tert-butyl-2-chlorophenyl)methyl-methoxyamino]phosphonic acid |
|---|---|
| PubChem CID | 172798184 |
| Molecular Formula | C12H19ClNO4P |
| Molecular Weight | 307.71 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | [(4-tert-butyl-2-chlorophenyl)methyl-methoxyamino]phosphonic acid |
| SMILES | CON(Cc1ccc(C(C)(C)C)cc1Cl)P(=O)(O)O |
| InChI | InChI=1S/C12H19ClNO4P/c1-12(2,3)10-6-5-9(11(13)7-10)8-14(18-4)19(15,16)17/h5-7H,8H2,1-4H3,(H2,15,16,17) |
| InChIKey | QMLRWYSZYRNYHZ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.71 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|