C22H22N2O2 — CID 172798911
[[3,5-bis(prop-1-enyl)phenyl]-(4-cyanoanilino)methyl] acetate (PubChem CID 172798911) has the molecular formula C22H22N2O2 and a molecular weight of 346.43 g/mol. Its IUPAC name is [[3,5-bis(prop-1-enyl)phenyl]-(4-cyanoanilino)methyl] acetate.
| Compound Name | [[3,5-bis(prop-1-enyl)phenyl]-(4-cyanoanilino)methyl] acetate |
|---|---|
| PubChem CID | 172798911 |
| Molecular Formula | C22H22N2O2 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | [[3,5-bis(prop-1-enyl)phenyl]-(4-cyanoanilino)methyl] acetate |
| SMILES | CC=Cc1cc(C=CC)cc(C(Nc2ccc(C#N)cc2)OC(C)=O)c1 |
| InChI | InChI=1S/C22H22N2O2/c1-4-6-18-12-19(7-5-2)14-20(13-18)22(26-16(3)25)24-21-10-8-17(15-23)9-11-21/h4-14,22,24H,1-3H3 |
| InChIKey | QOUVBSNPMNTUDQ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|