C18H14N2O4 — CID 86583533
methyl 2-(4-cyanoanilino)-2-(3,5-diformylphenyl)acetate (PubChem CID 86583533) has the molecular formula C18H14N2O4 and a molecular weight of 322.32 g/mol. Its IUPAC name is methyl 2-(4-cyanoanilino)-2-(3,5-diformylphenyl)acetate.
| Compound Name | methyl 2-(4-cyanoanilino)-2-(3,5-diformylphenyl)acetate |
|---|---|
| PubChem CID | 86583533 |
| Molecular Formula | C18H14N2O4 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | methyl 2-(4-cyanoanilino)-2-(3,5-diformylphenyl)acetate |
| SMILES | COC(=O)C(Nc1ccc(C#N)cc1)c1cc(C=O)cc(C=O)c1 |
| InChI | InChI=1S/C18H14N2O4/c1-24-18(23)17(20-16-4-2-12(9-19)3-5-16)15-7-13(10-21)6-14(8-15)11-22/h2-8,10-11,17,20H,1H3 |
| InChIKey | UWDODFNMDSXMBU-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|