C15H19FN2O3S — CID 172800019
4-[(4-fluorophenyl)methyl]-1-oxa-3-thia-4,9-diazaspiro[5.5]undecane-9-carboxylic acid (PubChem CID 172800019) has the molecular formula C15H19FN2O3S and a molecular weight of 326.39 g/mol. Its IUPAC name is 4-[(4-fluorophenyl)methyl]-1-oxa-3-thia-4,9-diazaspiro[5.5]undecane-9-carboxylic acid.
| Compound Name | 4-[(4-fluorophenyl)methyl]-1-oxa-3-thia-4,9-diazaspiro[5.5]undecane-9-carboxylic acid |
|---|---|
| PubChem CID | 172800019 |
| Molecular Formula | C15H19FN2O3S |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 4-[(4-fluorophenyl)methyl]-1-oxa-3-thia-4,9-diazaspiro[5.5]undecane-9-carboxylic acid |
| SMILES | O=C(O)N1CCC2(CC1)CN(Cc1ccc(F)cc1)SCO2 |
| InChI | InChI=1S/C15H19FN2O3S/c16-13-3-1-12(2-4-13)9-18-10-15(21-11-22-18)5-7-17(8-6-15)14(19)20/h1-4H,5-11H2,(H,19,20) |
| InChIKey | QSTYXEGIBQKWKD-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|