C12H21NO — CID 172800035
(3aR,6aS)-3-tert-butyl-6a-methyl-1,2,3,3a,4,6-hexahydrocyclopenta[c]pyrrol-5-one (PubChem CID 172800035) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is (3aR,6aS)-3-tert-butyl-6a-methyl-1,2,3,3a,4,6-hexahydrocyclopenta[c]pyrrol-5-one.
| Compound Name | (3aR,6aS)-3-tert-butyl-6a-methyl-1,2,3,3a,4,6-hexahydrocyclopenta[c]pyrrol-5-one |
|---|---|
| PubChem CID | 172800035 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | (3aR,6aS)-3-tert-butyl-6a-methyl-1,2,3,3a,4,6-hexahydrocyclopenta[c]pyrrol-5-one |
| SMILES | CC(C)(C)C1NC[C@@]2(C)CC(=O)C[C@@H]12 |
| InChI | InChI=1S/C12H21NO/c1-11(2,3)10-9-5-8(14)6-12(9,4)7-13-10/h9-10,13H,5-7H2,1-4H3/t9-,10?,12+/m0/s1 |
| InChIKey | QSUXEPGBSRQMDF-VXFCFVAISA-N |
| XLogP | 1.99 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |