About aziridin-1-yl propanoate;carbamic acid;pyridine
aziridin-1-yl propanoate;carbamic acid;pyridine (PubChem CID 172801378) has the molecular formula C11H17N3O4
and a molecular weight of 255.27 g/mol. Its IUPAC name is aziridin-1-yl propanoate;carbamic acid;pyridine.
Molecular Properties
| Compound Name | aziridin-1-yl propanoate;carbamic acid;pyridine |
| PubChem CID | 172801378 |
| Molecular Formula | C11H17N3O4 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | aziridin-1-yl propanoate;carbamic acid;pyridine |
| SMILES | CCC(=O)ON1CC1.NC(=O)O.c1ccncc1 |
| InChI | InChI=1S/C5H9NO2.C5H5N.CH3NO2/c1-2-5(7)8-6-3-4-6;1-2-4-6-5-3-1;2-1(3)4/h2-4H2,1H3;1-5H;2H2,(H,3,4) |
| InChIKey | QXJDUVUTQXWROS-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 105.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze aziridin-1-yl propanoate;carbamic acid;pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aziridin-1-yl propanoate;carbamic acid;pyridine?
The IUPAC name of aziridin-1-yl propanoate;carbamic acid;pyridine (CID 172801378) is aziridin-1-yl propanoate;carbamic acid;pyridine.
What is the SMILES notation for aziridin-1-yl propanoate;carbamic acid;pyridine?
The canonical SMILES for aziridin-1-yl propanoate;carbamic acid;pyridine is CCC(=O)ON1CC1.NC(=O)O.c1ccncc1.
What is the InChIKey of aziridin-1-yl propanoate;carbamic acid;pyridine?
The InChIKey is QXJDUVUTQXWROS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO2.C5H5N.CH3NO2/c1-2-5(7)8-6-3-4-6;1-2-4-6-5-3-1;2-1(3)4/h2-4H2,1H3;1-5H;2H2,(H,3,4).
What are the key properties of aziridin-1-yl propanoate;carbamic acid;pyridine?
aziridin-1-yl propanoate;carbamic acid;pyridine has a molecular weight of 255.27 g/mol, XLogP of 0.87, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for aziridin-1-yl propanoate;carbamic acid;pyridine is sourced from PubChem (CID 172801378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).