C21H31NO2 — CID 172805233
5-(10,10-dimethylundecyl)-3-ethynylpyridine-2-carboxylic acid (PubChem CID 172805233) has the molecular formula C21H31NO2 and a molecular weight of 329.48 g/mol. Its IUPAC name is 5-(10,10-dimethylundecyl)-3-ethynylpyridine-2-carboxylic acid.
| Compound Name | 5-(10,10-dimethylundecyl)-3-ethynylpyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 172805233 |
| Molecular Formula | C21H31NO2 |
| Molecular Weight | 329.48 g/mol |
| Exact Mass | 329.24 |
| IUPAC Name | 5-(10,10-dimethylundecyl)-3-ethynylpyridine-2-carboxylic acid |
| SMILES | C#Cc1cc(CCCCCCCCCC(C)(C)C)cnc1C(=O)O |
| InChI | InChI=1S/C21H31NO2/c1-5-18-15-17(16-22-19(18)20(23)24)13-11-9-7-6-8-10-12-14-21(2,3)4/h1,15-16H,6-14H2,2-4H3,(H,23,24) |
| InChIKey | RKMVVFKYDYDJQH-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.48 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|