C29H34F3N5O3 — CID 172807321
1-[3-[4-[[(1R)-1-[3-(difluoromethyl)-2-fluorophenyl]ethyl]amino]-7-hydroxy-2,8,8-trimethyl-7H-pyrimido[5,4-g][1,4]benzoxazin-6-yl]pyrrolidin-1-yl]propan-1-one (PubChem CID 172807321) has the molecular formula C29H34F3N5O3 and a molecular weight of 557.62 g/mol. Its IUPAC name is 1-[3-[4-[[(1R)-1-[3-(difluoromethyl)-2-fluorophenyl]ethyl]amino]-7-hydroxy-2,8,8-trimethyl-7H-pyrimido[5,4-g][1,4]benzoxazin-6-yl]pyrrolidin-1-yl]propan-1-one.
| Compound Name | 1-[3-[4-[[(1R)-1-[3-(difluoromethyl)-2-fluorophenyl]ethyl]amino]-7-hydroxy-2,8,8-trimethyl-7H-pyrimido[5,4-g][1,4]benzoxazin-6-yl]pyrrolidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 172807321 |
| Molecular Formula | C29H34F3N5O3 |
| Molecular Weight | 557.62 g/mol |
| Exact Mass | 557.26 |
| IUPAC Name | 1-[3-[4-[[(1R)-1-[3-(difluoromethyl)-2-fluorophenyl]ethyl]amino]-7-hydroxy-2,8,8-trimethyl-7H-pyrimido[5,4-g][1,4]benzoxazin-6-yl]pyrrolidin-1-yl]propan-1-one |
| SMILES | CCC(=O)N1CCC(N2c3cc4c(N[C@H](C)c5cccc(C(F)F)c5F)nc(C)nc4cc3OC(C)(C)C2O)C1 |
| InChI | InChI=1S/C29H34F3N5O3/c1-6-24(38)36-11-10-17(14-36)37-22-12-20-21(13-23(22)40-29(4,5)28(37)39)34-16(3)35-27(20)33-15(2)18-8-7-9-19(25(18)30)26(31)32/h7-9,12-13,15,17,26,28,39H,6,10-11,14H2,1-5H3,(H,33,34,35)/t15-,17?,28?/m1/s1 |
| InChIKey | RRPMHFNXIKYJAN-SDLXZWLTSA-N |
| XLogP | 5.49 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.62 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |