C22H21N3O5S — CID 172813578
3-(1-amino-4b-hydroxy-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-9b-yl)-2-oxo-1,3-thiazolidine-4-carboxamide (PubChem CID 172813578) has the molecular formula C22H21N3O5S and a molecular weight of 439.49 g/mol. Its IUPAC name is 3-(1-amino-4b-hydroxy-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-9b-yl)-2-oxo-1,3-thiazolidine-4-carboxamide.
| Compound Name | 3-(1-amino-4b-hydroxy-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-9b-yl)-2-oxo-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 172813578 |
| Molecular Formula | C22H21N3O5S |
| Molecular Weight | 439.49 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | 3-(1-amino-4b-hydroxy-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-9b-yl)-2-oxo-1,3-thiazolidine-4-carboxamide |
| SMILES | CC(C)c1ccc2c(c1)OC1(O)c3cccc(N)c3C(=O)C21N1C(=O)SCC1C(N)=O |
| InChI | InChI=1S/C22H21N3O5S/c1-10(2)11-6-7-12-16(8-11)30-22(29)13-4-3-5-14(23)17(13)18(26)21(12,22)25-15(19(24)27)9-31-20(25)28/h3-8,10,15,29H,9,23H2,1-2H3,(H2,24,27) |
| InChIKey | SNAIBTCEFWTAOK-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 135.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.49 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|