About (3R,4R)-4-(4-chlorophenoxy)-3-phenyl-1-(1-phenylethyl)piperidine;hydrochloride
(3R,4R)-4-(4-chlorophenoxy)-3-phenyl-1-(1-phenylethyl)piperidine;hydrochloride (PubChem CID 172816174) has the molecular formula C25H27Cl2NO
and a molecular weight of 428.40 g/mol. Its IUPAC name is (3R,4R)-4-(4-chlorophenoxy)-3-phenyl-1-(1-phenylethyl)piperidine;hydrochloride.
Molecular Properties
| Compound Name | (3R,4R)-4-(4-chlorophenoxy)-3-phenyl-1-(1-phenylethyl)piperidine;hydrochloride |
| PubChem CID | 172816174 |
| Molecular Formula | C25H27Cl2NO |
| Molecular Weight | 428.40 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | (3R,4R)-4-(4-chlorophenoxy)-3-phenyl-1-(1-phenylethyl)piperidine;hydrochloride |
| SMILES | CC(c1ccccc1)N1CC[C@@H](Oc2ccc(Cl)cc2)[C@H](c2ccccc2)C1.Cl |
| InChI | InChI=1S/C25H26ClNO.ClH/c1-19(20-8-4-2-5-9-20)27-17-16-25(28-23-14-12-22(26)13-15-23)24(18-27)21-10-6-3-7-11-21;/h2-15,19,24-25H,16-18H2,1H3;1H/t19?,24-,25+;/m0./s1 |
| InChIKey | SVIYXQBSAPLSAB-MSAZGOLZSA-N |
| XLogP | 6.76 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.40 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3R,4R)-4-(4-chlorophenoxy)-3-phenyl-1-(1-phenylethyl)piperidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4R)-4-(4-chlorophenoxy)-3-phenyl-1-(1-phenylethyl)piperidine;hydrochloride?
The IUPAC name of (3R,4R)-4-(4-chlorophenoxy)-3-phenyl-1-(1-phenylethyl)piperidine;hydrochloride (CID 172816174) is (3R,4R)-4-(4-chlorophenoxy)-3-phenyl-1-(1-phenylethyl)piperidine;hydrochloride.
What is the SMILES notation for (3R,4R)-4-(4-chlorophenoxy)-3-phenyl-1-(1-phenylethyl)piperidine;hydrochloride?
The canonical SMILES for (3R,4R)-4-(4-chlorophenoxy)-3-phenyl-1-(1-phenylethyl)piperidine;hydrochloride is CC(c1ccccc1)N1CC[C@@H](Oc2ccc(Cl)cc2)[C@H](c2ccccc2)C1.Cl.
What is the InChIKey of (3R,4R)-4-(4-chlorophenoxy)-3-phenyl-1-(1-phenylethyl)piperidine;hydrochloride?
The InChIKey is SVIYXQBSAPLSAB-MSAZGOLZSA-N. The full InChI is InChI=1S/C25H26ClNO.ClH/c1-19(20-8-4-2-5-9-20)27-17-16-25(28-23-14-12-22(26)13-15-23)24(18-27)21-10-6-3-7-11-21;/h2-15,19,24-25H,16-18H2,1H3;1H/t19?,24-,25+;/m0./s1.
What are the key properties of (3R,4R)-4-(4-chlorophenoxy)-3-phenyl-1-(1-phenylethyl)piperidine;hydrochloride?
(3R,4R)-4-(4-chlorophenoxy)-3-phenyl-1-(1-phenylethyl)piperidine;hydrochloride has a molecular weight of 428.40 g/mol, XLogP of 6.76, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4R)-4-(4-chlorophenoxy)-3-phenyl-1-(1-phenylethyl)piperidine;hydrochloride is sourced from PubChem (CID 172816174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).