About 4-[(3S,4R)-1-[1-(2-aminophenyl)propan-2-yl]-3-phenylpiperidin-4-yl]oxybenzonitrile
4-[(3S,4R)-1-[1-(2-aminophenyl)propan-2-yl]-3-phenylpiperidin-4-yl]oxybenzonitrile (PubChem CID 54118638) has the molecular formula C27H29N3O
and a molecular weight of 411.55 g/mol. Its IUPAC name is 4-[(3S,4R)-1-[1-(2-aminophenyl)propan-2-yl]-3-phenylpiperidin-4-yl]oxybenzonitrile.
Molecular Properties
| Compound Name | 4-[(3S,4R)-1-[1-(2-aminophenyl)propan-2-yl]-3-phenylpiperidin-4-yl]oxybenzonitrile |
| PubChem CID | 54118638 |
| Molecular Formula | C27H29N3O |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.23 |
| IUPAC Name | 4-[(3S,4R)-1-[1-(2-aminophenyl)propan-2-yl]-3-phenylpiperidin-4-yl]oxybenzonitrile |
| SMILES | CC(Cc1ccccc1N)N1CC[C@@H](Oc2ccc(C#N)cc2)[C@@H](c2ccccc2)C1 |
| InChI | InChI=1S/C27H29N3O/c1-20(17-23-9-5-6-10-26(23)29)30-16-15-27(25(19-30)22-7-3-2-4-8-22)31-24-13-11-21(18-28)12-14-24/h2-14,20,25,27H,15-17,19,29H2,1H3/t20?,25-,27-/m1/s1 |
| InChIKey | NMBWOMFEIPOSEK-YZPFRRHKSA-N |
| XLogP | 5.01 |
| TPSA | 62.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-[(3S,4R)-1-[1-(2-aminophenyl)propan-2-yl]-3-phenylpiperidin-4-yl]oxybenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3S,4R)-1-[1-(2-aminophenyl)propan-2-yl]-3-phenylpiperidin-4-yl]oxybenzonitrile?
The IUPAC name of 4-[(3S,4R)-1-[1-(2-aminophenyl)propan-2-yl]-3-phenylpiperidin-4-yl]oxybenzonitrile (CID 54118638) is 4-[(3S,4R)-1-[1-(2-aminophenyl)propan-2-yl]-3-phenylpiperidin-4-yl]oxybenzonitrile.
What is the SMILES notation for 4-[(3S,4R)-1-[1-(2-aminophenyl)propan-2-yl]-3-phenylpiperidin-4-yl]oxybenzonitrile?
The canonical SMILES for 4-[(3S,4R)-1-[1-(2-aminophenyl)propan-2-yl]-3-phenylpiperidin-4-yl]oxybenzonitrile is CC(Cc1ccccc1N)N1CC[C@@H](Oc2ccc(C#N)cc2)[C@@H](c2ccccc2)C1.
What is the InChIKey of 4-[(3S,4R)-1-[1-(2-aminophenyl)propan-2-yl]-3-phenylpiperidin-4-yl]oxybenzonitrile?
The InChIKey is NMBWOMFEIPOSEK-YZPFRRHKSA-N. The full InChI is InChI=1S/C27H29N3O/c1-20(17-23-9-5-6-10-26(23)29)30-16-15-27(25(19-30)22-7-3-2-4-8-22)31-24-13-11-21(18-28)12-14-24/h2-14,20,25,27H,15-17,19,29H2,1H3/t20?,25-,27-/m1/s1.
What are the key properties of 4-[(3S,4R)-1-[1-(2-aminophenyl)propan-2-yl]-3-phenylpiperidin-4-yl]oxybenzonitrile?
4-[(3S,4R)-1-[1-(2-aminophenyl)propan-2-yl]-3-phenylpiperidin-4-yl]oxybenzonitrile has a molecular weight of 411.55 g/mol, XLogP of 5.01, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3S,4R)-1-[1-(2-aminophenyl)propan-2-yl]-3-phenylpiperidin-4-yl]oxybenzonitrile is sourced from PubChem (CID 54118638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).