C29H32BrF6N5O3 — CID 172816305
tert-butyl (2R,4S)-5-amino-4-[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-bromopyrimidin-2-yl]-2-ethyl-6-methoxy-2,3,4,4a-tetrahydro-1,5-naphthyridine-1-carboxylate (PubChem CID 172816305) has the molecular formula C29H32BrF6N5O3 and a molecular weight of 692.50 g/mol. Its IUPAC name is tert-butyl (2R,4S)-5-amino-4-[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-bromopyrimidin-2-yl]-2-ethyl-6-methoxy-2,3,4,4a-tetrahydro-1,5-naphthyridine-1-carboxylate.
| Compound Name | tert-butyl (2R,4S)-5-amino-4-[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-bromopyrimidin-2-yl]-2-ethyl-6-methoxy-2,3,4,4a-tetrahydro-1,5-naphthyridine-1-carboxylate |
|---|---|
| PubChem CID | 172816305 |
| Molecular Formula | C29H32BrF6N5O3 |
| Molecular Weight | 692.50 g/mol |
| Exact Mass | 691.16 |
| IUPAC Name | tert-butyl (2R,4S)-5-amino-4-[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-bromopyrimidin-2-yl]-2-ethyl-6-methoxy-2,3,4,4a-tetrahydro-1,5-naphthyridine-1-carboxylate |
| SMILES | CC[C@@H]1C[C@H](c2ncc(Br)c(Cc3cc(C(F)(F)F)cc(C(F)(F)F)c3)n2)C2C(=CC=C(OC)N2N)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C29H32BrF6N5O3/c1-6-18-13-19(24-22(7-8-23(43-5)41(24)37)40(18)26(42)44-27(2,3)4)25-38-14-20(30)21(39-25)11-15-9-16(28(31,32)33)12-17(10-15)29(34,35)36/h7-10,12,14,18-19,24H,6,11,13,37H2,1-5H3/t18-,19+,24?/m1/s1 |
| InChIKey | SVXMTCYUPWMPHH-WEAPTXNRSA-N |
| XLogP | 7.30 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.50 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|