C28H36O7 — CID 172824356
[2-[[(1R,3S,4S,6R,7R,8R,12R)-4-ethenyl-3-hydroxy-4,7,12-trimethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl]oxy]-2-oxoethyl] 2-hydroxybenzoate (PubChem CID 172824356) has the molecular formula C28H36O7 and a molecular weight of 484.59 g/mol. Its IUPAC name is [2-[[(1R,3S,4S,6R,7R,8R,12R)-4-ethenyl-3-hydroxy-4,7,12-trimethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl]oxy]-2-oxoethyl] 2-hydroxybenzoate.
| Compound Name | [2-[[(1R,3S,4S,6R,7R,8R,12R)-4-ethenyl-3-hydroxy-4,7,12-trimethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl]oxy]-2-oxoethyl] 2-hydroxybenzoate |
|---|---|
| PubChem CID | 172824356 |
| Molecular Formula | C28H36O7 |
| Molecular Weight | 484.59 g/mol |
| Exact Mass | 484.25 |
| IUPAC Name | [2-[[(1R,3S,4S,6R,7R,8R,12R)-4-ethenyl-3-hydroxy-4,7,12-trimethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl]oxy]-2-oxoethyl] 2-hydroxybenzoate |
| SMILES | C=C[C@]1(C)C[C@@H](OC(=O)COC(=O)c2ccccc2O)[C@]2(C)CC[C@@H](C)[C@@]3(CCC(=O)[C@@H]23)C[C@@H]1O |
| InChI | InChI=1S/C28H36O7/c1-5-26(3)15-22(35-23(32)16-34-25(33)18-8-6-7-9-19(18)29)27(4)12-10-17(2)28(14-21(26)31)13-11-20(30)24(27)28/h5-9,17,21-22,24,29,31H,1,10-16H2,2-4H3/t17-,21+,22-,24+,26-,27+,28-/m1/s1 |
| InChIKey | UQUKTPQJCAAJJB-QCOQQPMASA-N |
| XLogP | 4.21 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.59 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|