C18H18FN3O2S — CID 172826228
2-[1-[1-tert-butyl-5-(4-fluorophenyl)pyrazol-4-yl]-1,3-thiazol-1-ium-4-yl]acetate (PubChem CID 172826228) has the molecular formula C18H18FN3O2S and a molecular weight of 359.43 g/mol. Its IUPAC name is 2-[1-[1-tert-butyl-5-(4-fluorophenyl)pyrazol-4-yl]-1,3-thiazol-1-ium-4-yl]acetate.
| Compound Name | 2-[1-[1-tert-butyl-5-(4-fluorophenyl)pyrazol-4-yl]-1,3-thiazol-1-ium-4-yl]acetate |
|---|---|
| PubChem CID | 172826228 |
| Molecular Formula | C18H18FN3O2S |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | 2-[1-[1-tert-butyl-5-(4-fluorophenyl)pyrazol-4-yl]-1,3-thiazol-1-ium-4-yl]acetate |
| SMILES | CC(C)(C)n1ncc(-[s+]2cnc(CC(=O)[O-])c2)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C18H18FN3O2S/c1-18(2,3)22-17(12-4-6-13(19)7-5-12)15(9-21-22)25-10-14(20-11-25)8-16(23)24/h4-7,9-11H,8H2,1-3H3 |
| InChIKey | UWZPQQHUPGNQSI-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 70.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|