C15H14N3- — CID 172828479
1-benzyl-4-phenyl-1,3-diaza-2-azanidacyclopent-3-ene (PubChem CID 172828479) has the molecular formula C15H14N3- and a molecular weight of 236.30 g/mol. Its IUPAC name is 1-benzyl-4-phenyl-1,3-diaza-2-azanidacyclopent-3-ene.
| Compound Name | 1-benzyl-4-phenyl-1,3-diaza-2-azanidacyclopent-3-ene |
|---|---|
| PubChem CID | 172828479 |
| Molecular Formula | C15H14N3- |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 1-benzyl-4-phenyl-1,3-diaza-2-azanidacyclopent-3-ene |
| SMILES | c1ccc(CN2CC(c3ccccc3)=N[N-]2)cc1 |
| InChI | InChI=1S/C15H14N3/c1-3-7-13(8-4-1)11-18-12-15(16-17-18)14-9-5-2-6-10-14/h1-10H,11-12H2/q-1 |
| InChIKey | VETZHCWUWAPZDW-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 29.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |