C19H30N6O3 — CID 172830341
tert-butyl 4-[3-(6-amino-7H-purin-2-yl)propoxymethyl]piperidine-1-carboxylate (PubChem CID 172830341) has the molecular formula C19H30N6O3 and a molecular weight of 390.49 g/mol. Its IUPAC name is tert-butyl 4-[3-(6-amino-7H-purin-2-yl)propoxymethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-(6-amino-7H-purin-2-yl)propoxymethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 172830341 |
| Molecular Formula | C19H30N6O3 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | tert-butyl 4-[3-(6-amino-7H-purin-2-yl)propoxymethyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(COCCCc2nc(N)c3[nH]cnc3n2)CC1 |
| InChI | InChI=1S/C19H30N6O3/c1-19(2,3)28-18(26)25-8-6-13(7-9-25)11-27-10-4-5-14-23-16(20)15-17(24-14)22-12-21-15/h12-13H,4-11H2,1-3H3,(H3,20,21,22,23,24) |
| InChIKey | VKVBJYMHXBHOEX-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 119.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|