C23H30N2O3 — CID 172830718
methyl 4-[N-ethyl-3-(3-methylbut-2-enoxy)-4-propan-2-ylanilino]pyridine-3-carboxylate (PubChem CID 172830718) has the molecular formula C23H30N2O3 and a molecular weight of 382.50 g/mol. Its IUPAC name is methyl 4-[N-ethyl-3-(3-methylbut-2-enoxy)-4-propan-2-ylanilino]pyridine-3-carboxylate.
| Compound Name | methyl 4-[N-ethyl-3-(3-methylbut-2-enoxy)-4-propan-2-ylanilino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 172830718 |
| Molecular Formula | C23H30N2O3 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | methyl 4-[N-ethyl-3-(3-methylbut-2-enoxy)-4-propan-2-ylanilino]pyridine-3-carboxylate |
| SMILES | CCN(c1ccc(C(C)C)c(OCC=C(C)C)c1)c1ccncc1C(=O)OC |
| InChI | InChI=1S/C23H30N2O3/c1-7-25(21-10-12-24-15-20(21)23(26)27-6)18-8-9-19(17(4)5)22(14-18)28-13-11-16(2)3/h8-12,14-15,17H,7,13H2,1-6H3 |
| InChIKey | VLZHORJVAMZEGF-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|