C27H32N2O3 — CID 172681586
methyl 4-[N-ethyl-3-(3-phenylpropoxy)-4-propan-2-ylanilino]pyridine-3-carboxylate (PubChem CID 172681586) has the molecular formula C27H32N2O3 and a molecular weight of 432.56 g/mol. Its IUPAC name is methyl 4-[N-ethyl-3-(3-phenylpropoxy)-4-propan-2-ylanilino]pyridine-3-carboxylate.
| Compound Name | methyl 4-[N-ethyl-3-(3-phenylpropoxy)-4-propan-2-ylanilino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 172681586 |
| Molecular Formula | C27H32N2O3 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | methyl 4-[N-ethyl-3-(3-phenylpropoxy)-4-propan-2-ylanilino]pyridine-3-carboxylate |
| SMILES | CCN(c1ccc(C(C)C)c(OCCCc2ccccc2)c1)c1ccncc1C(=O)OC |
| InChI | InChI=1S/C27H32N2O3/c1-5-29(25-15-16-28-19-24(25)27(30)31-4)22-13-14-23(20(2)3)26(18-22)32-17-9-12-21-10-7-6-8-11-21/h6-8,10-11,13-16,18-20H,5,9,12,17H2,1-4H3 |
| InChIKey | ALZXRYHCYNYARD-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|