C26H29NO5S — CID 91240763
methyl 5-[(4-phenylphenyl)-propoxysulfamoyl]-2-propan-2-ylbenzoate (PubChem CID 91240763) has the molecular formula C26H29NO5S and a molecular weight of 467.59 g/mol. Its IUPAC name is methyl 5-[(4-phenylphenyl)-propoxysulfamoyl]-2-propan-2-ylbenzoate.
| Compound Name | methyl 5-[(4-phenylphenyl)-propoxysulfamoyl]-2-propan-2-ylbenzoate |
|---|---|
| PubChem CID | 91240763 |
| Molecular Formula | C26H29NO5S |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | methyl 5-[(4-phenylphenyl)-propoxysulfamoyl]-2-propan-2-ylbenzoate |
| SMILES | CCCON(c1ccc(-c2ccccc2)cc1)S(=O)(=O)c1ccc(C(C)C)c(C(=O)OC)c1 |
| InChI | InChI=1S/C26H29NO5S/c1-5-17-32-27(22-13-11-21(12-14-22)20-9-7-6-8-10-20)33(29,30)23-15-16-24(19(2)3)25(18-23)26(28)31-4/h6-16,18-19H,5,17H2,1-4H3 |
| InChIKey | CKQXIDPNHFURKO-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|