C34H48N4O3 — CID 172831021
1-[3-[4-(4-cyanophenyl)-4-(3,4-dimethoxyphenyl)butyl]-3-azabicyclo[3.2.1]octan-8-yl]-3-hexyl-1-methylurea (PubChem CID 172831021) has the molecular formula C34H48N4O3 and a molecular weight of 560.78 g/mol. Its IUPAC name is 1-[3-[4-(4-cyanophenyl)-4-(3,4-dimethoxyphenyl)butyl]-3-azabicyclo[3.2.1]octan-8-yl]-3-hexyl-1-methylurea.
| Compound Name | 1-[3-[4-(4-cyanophenyl)-4-(3,4-dimethoxyphenyl)butyl]-3-azabicyclo[3.2.1]octan-8-yl]-3-hexyl-1-methylurea |
|---|---|
| PubChem CID | 172831021 |
| Molecular Formula | C34H48N4O3 |
| Molecular Weight | 560.78 g/mol |
| Exact Mass | 560.37 |
| IUPAC Name | 1-[3-[4-(4-cyanophenyl)-4-(3,4-dimethoxyphenyl)butyl]-3-azabicyclo[3.2.1]octan-8-yl]-3-hexyl-1-methylurea |
| SMILES | CCCCCCNC(=O)N(C)C1C2CCC1CN(CCCC(c1ccc(C#N)cc1)c1ccc(OC)c(OC)c1)C2 |
| InChI | InChI=1S/C34H48N4O3/c1-5-6-7-8-19-36-34(39)37(2)33-28-15-16-29(33)24-38(23-28)20-9-10-30(26-13-11-25(22-35)12-14-26)27-17-18-31(40-3)32(21-27)41-4/h11-14,17-18,21,28-30,33H,5-10,15-16,19-20,23-24H2,1-4H3,(H,36,39) |
| InChIKey | VMYJXBJTYSPZDO-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.78 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|