C63H45N3 — CID 172831162
2,4-diphenyl-6-[1-phenyl-5-[3-(2,3,4,5-tetraphenylphenyl)phenyl]cyclohexa-2,4-dien-1-yl]-1,3,5-triazine (PubChem CID 172831162) has the molecular formula C63H45N3 and a molecular weight of 844.07 g/mol. Its IUPAC name is 2,4-diphenyl-6-[1-phenyl-5-[3-(2,3,4,5-tetraphenylphenyl)phenyl]cyclohexa-2,4-dien-1-yl]-1,3,5-triazine.
| Compound Name | 2,4-diphenyl-6-[1-phenyl-5-[3-(2,3,4,5-tetraphenylphenyl)phenyl]cyclohexa-2,4-dien-1-yl]-1,3,5-triazine |
|---|---|
| PubChem CID | 172831162 |
| Molecular Formula | C63H45N3 |
| Molecular Weight | 844.07 g/mol |
| Exact Mass | 843.36 |
| IUPAC Name | 2,4-diphenyl-6-[1-phenyl-5-[3-(2,3,4,5-tetraphenylphenyl)phenyl]cyclohexa-2,4-dien-1-yl]-1,3,5-triazine |
| SMILES | C1=CC(c2ccccc2)(c2nc(-c3ccccc3)nc(-c3ccccc3)n2)CC(c2cccc(-c3cc(-c4ccccc4)c(-c4ccccc4)c(-c4ccccc4)c3-c3ccccc3)c2)=C1 |
| InChI | InChI=1S/C63H45N3/c1-8-24-45(25-9-1)55-43-56(58(47-28-12-3-13-29-47)59(48-30-14-4-15-31-48)57(55)46-26-10-2-11-27-46)52-37-22-36-51(42-52)53-38-23-41-63(44-53,54-39-20-7-21-40-54)62-65-60(49-32-16-5-17-33-49)64-61(66-62)50-34-18-6-19-35-50/h1-43H,44H2 |
| InChIKey | VNKNAYBIWDYFBV-UHFFFAOYSA-N |
| XLogP | 15.87 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 844.07 |
| LogP ≤ 5 | 15.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |