C22H32O2 — CID 172831869
2-cyclohexylpropan-2-yl tetracyclo[6.2.1.13,6.02,7]dodec-4-ene-4-carboxylate (PubChem CID 172831869) has the molecular formula C22H32O2 and a molecular weight of 328.50 g/mol. Its IUPAC name is 2-cyclohexylpropan-2-yl tetracyclo[6.2.1.13,6.02,7]dodec-4-ene-4-carboxylate.
| Compound Name | 2-cyclohexylpropan-2-yl tetracyclo[6.2.1.13,6.02,7]dodec-4-ene-4-carboxylate |
|---|---|
| PubChem CID | 172831869 |
| Molecular Formula | C22H32O2 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | 2-cyclohexylpropan-2-yl tetracyclo[6.2.1.13,6.02,7]dodec-4-ene-4-carboxylate |
| SMILES | CC(C)(OC(=O)C1=CC2CC1C1C3CCC(C3)C21)C1CCCCC1 |
| InChI | InChI=1S/C22H32O2/c1-22(2,16-6-4-3-5-7-16)24-21(23)18-12-15-11-17(18)20-14-9-8-13(10-14)19(15)20/h12-17,19-20H,3-11H2,1-2H3 |
| InChIKey | VPSRMXCUMMYYMH-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|