C18H18O6 — CID 172834763
4-(3,5-dimethoxyphenyl)-2-ethylbenzene-1,3-dicarboxylic acid (PubChem CID 172834763) has the molecular formula C18H18O6 and a molecular weight of 330.34 g/mol. Its IUPAC name is 4-(3,5-dimethoxyphenyl)-2-ethylbenzene-1,3-dicarboxylic acid.
| Compound Name | 4-(3,5-dimethoxyphenyl)-2-ethylbenzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 172834763 |
| Molecular Formula | C18H18O6 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | 4-(3,5-dimethoxyphenyl)-2-ethylbenzene-1,3-dicarboxylic acid |
| SMILES | CCc1c(C(=O)O)ccc(-c2cc(OC)cc(OC)c2)c1C(=O)O |
| InChI | InChI=1S/C18H18O6/c1-4-13-15(17(19)20)6-5-14(16(13)18(21)22)10-7-11(23-2)9-12(8-10)24-3/h5-9H,4H2,1-3H3,(H,19,20)(H,21,22) |
| InChIKey | VZQYQQXHMZWLRJ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |