About azane;ethyl 2-(1-benzyl-2H-pyridin-3-yl)acetate
azane;ethyl 2-(1-benzyl-2H-pyridin-3-yl)acetate (PubChem CID 172838002) has the molecular formula C16H22N2O2
and a molecular weight of 274.36 g/mol. Its IUPAC name is azane;ethyl 2-(1-benzyl-2H-pyridin-3-yl)acetate.
Molecular Properties
| Compound Name | azane;ethyl 2-(1-benzyl-2H-pyridin-3-yl)acetate |
| PubChem CID | 172838002 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | azane;ethyl 2-(1-benzyl-2H-pyridin-3-yl)acetate |
| SMILES | CCOC(=O)CC1=CC=CN(Cc2ccccc2)C1.N |
| InChI | InChI=1S/C16H19NO2.H3N/c1-2-19-16(18)11-15-9-6-10-17(13-15)12-14-7-4-3-5-8-14;/h3-10H,2,11-13H2,1H3;1H3 |
| InChIKey | WKMDNKFZPNOUGT-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 64.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze azane;ethyl 2-(1-benzyl-2H-pyridin-3-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;ethyl 2-(1-benzyl-2H-pyridin-3-yl)acetate?
The IUPAC name of azane;ethyl 2-(1-benzyl-2H-pyridin-3-yl)acetate (CID 172838002) is azane;ethyl 2-(1-benzyl-2H-pyridin-3-yl)acetate.
What is the SMILES notation for azane;ethyl 2-(1-benzyl-2H-pyridin-3-yl)acetate?
The canonical SMILES for azane;ethyl 2-(1-benzyl-2H-pyridin-3-yl)acetate is CCOC(=O)CC1=CC=CN(Cc2ccccc2)C1.N.
What is the InChIKey of azane;ethyl 2-(1-benzyl-2H-pyridin-3-yl)acetate?
The InChIKey is WKMDNKFZPNOUGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO2.H3N/c1-2-19-16(18)11-15-9-6-10-17(13-15)12-14-7-4-3-5-8-14;/h3-10H,2,11-13H2,1H3;1H3.
What are the key properties of azane;ethyl 2-(1-benzyl-2H-pyridin-3-yl)acetate?
azane;ethyl 2-(1-benzyl-2H-pyridin-3-yl)acetate has a molecular weight of 274.36 g/mol, XLogP of 3.06, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;ethyl 2-(1-benzyl-2H-pyridin-3-yl)acetate is sourced from PubChem (CID 172838002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).