C16H25F2N — CID 172841035
N-(2-ethyl-2-methylheptyl)-2,4-difluoroaniline (PubChem CID 172841035) has the molecular formula C16H25F2N and a molecular weight of 269.38 g/mol. Its IUPAC name is N-(2-ethyl-2-methylheptyl)-2,4-difluoroaniline.
| Compound Name | N-(2-ethyl-2-methylheptyl)-2,4-difluoroaniline |
|---|---|
| PubChem CID | 172841035 |
| Molecular Formula | C16H25F2N |
| Molecular Weight | 269.38 g/mol |
| Exact Mass | 269.20 |
| IUPAC Name | N-(2-ethyl-2-methylheptyl)-2,4-difluoroaniline |
| SMILES | CCCCCC(C)(CC)CNc1ccc(F)cc1F |
| InChI | InChI=1S/C16H25F2N/c1-4-6-7-10-16(3,5-2)12-19-15-9-8-13(17)11-14(15)18/h8-9,11,19H,4-7,10,12H2,1-3H3 |
| InChIKey | FMPSYSWJDINSTB-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.38 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|