C13H16N4O7S — CID 172841071
1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-sulfanylidenepyrimidin-2-one;1H-pyrimidine-2,4-dione (PubChem CID 172841071) has the molecular formula C13H16N4O7S and a molecular weight of 372.36 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-sulfanylidenepyrimidin-2-one;1H-pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-sulfanylidenepyrimidin-2-one;1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 172841071 |
| Molecular Formula | C13H16N4O7S |
| Molecular Weight | 372.36 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-sulfanylidenepyrimidin-2-one;1H-pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=S)ccn1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O.O=c1cc[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C9H12N2O5S.C4H4N2O2/c12-3-4-6(13)7(14)8(16-4)11-2-1-5(17)10-9(11)15;7-3-1-2-5-4(8)6-3/h1-2,4,6-8,12-14H,3H2,(H,10,15,17);1-2H,(H2,5,6,7,8)/t4-,6-,7-,8-;/m1./s1 |
| InChIKey | WUMKGWYBEMIVAV-IAIGYFSYSA-N |
| XLogP | -2.42 |
| TPSA | 173.43 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.36 |
| LogP ≤ 5 | -2.42 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|