C21H27NO4 — CID 172841996
3-acetyl-1-(1-acetyl-4,4-dimethyl-2,3-dihydroquinolin-2-yl)hexane-1,4-dione (PubChem CID 172841996) has the molecular formula C21H27NO4 and a molecular weight of 357.45 g/mol. Its IUPAC name is 3-acetyl-1-(1-acetyl-4,4-dimethyl-2,3-dihydroquinolin-2-yl)hexane-1,4-dione.
| Compound Name | 3-acetyl-1-(1-acetyl-4,4-dimethyl-2,3-dihydroquinolin-2-yl)hexane-1,4-dione |
|---|---|
| PubChem CID | 172841996 |
| Molecular Formula | C21H27NO4 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | 3-acetyl-1-(1-acetyl-4,4-dimethyl-2,3-dihydroquinolin-2-yl)hexane-1,4-dione |
| SMILES | CCC(=O)C(CC(=O)C1CC(C)(C)c2ccccc2N1C(C)=O)C(C)=O |
| InChI | InChI=1S/C21H27NO4/c1-6-19(25)15(13(2)23)11-20(26)18-12-21(4,5)16-9-7-8-10-17(16)22(18)14(3)24/h7-10,15,18H,6,11-12H2,1-5H3 |
| InChIKey | WXLKRBHEADFCAY-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|