About 2-chloro-6-phenylphenol;piperidine
2-chloro-6-phenylphenol;piperidine (PubChem CID 172842774) has the molecular formula C17H20ClNO
and a molecular weight of 289.81 g/mol. Its IUPAC name is 2-chloro-6-phenylphenol;piperidine.
Molecular Properties
| Compound Name | 2-chloro-6-phenylphenol;piperidine |
| PubChem CID | 172842774 |
| Molecular Formula | C17H20ClNO |
| Molecular Weight | 289.81 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 2-chloro-6-phenylphenol;piperidine |
| SMILES | C1CCNCC1.Oc1c(Cl)cccc1-c1ccccc1 |
| InChI | InChI=1S/C12H9ClO.C5H11N/c13-11-8-4-7-10(12(11)14)9-5-2-1-3-6-9;1-2-4-6-5-3-1/h1-8,14H;6H,1-5H2 |
| InChIKey | XADRDQNWAUZAOK-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.81 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-chloro-6-phenylphenol;piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-6-phenylphenol;piperidine?
The IUPAC name of 2-chloro-6-phenylphenol;piperidine (CID 172842774) is 2-chloro-6-phenylphenol;piperidine.
What is the SMILES notation for 2-chloro-6-phenylphenol;piperidine?
The canonical SMILES for 2-chloro-6-phenylphenol;piperidine is C1CCNCC1.Oc1c(Cl)cccc1-c1ccccc1.
What is the InChIKey of 2-chloro-6-phenylphenol;piperidine?
The InChIKey is XADRDQNWAUZAOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9ClO.C5H11N/c13-11-8-4-7-10(12(11)14)9-5-2-1-3-6-9;1-2-4-6-5-3-1/h1-8,14H;6H,1-5H2.
What are the key properties of 2-chloro-6-phenylphenol;piperidine?
2-chloro-6-phenylphenol;piperidine has a molecular weight of 289.81 g/mol, XLogP of 4.47, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-6-phenylphenol;piperidine is sourced from PubChem (CID 172842774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).