C31H32N6O12S — CID 172844202
3-[[4-[(3-thiophen-2-ylpyrazol-1-yl)methyl]phenyl]methyl]-1,7,13,19-tetraoxa-4,10,16,22-tetrazacyclotetracosane-2,5,8,11,14,17,20,23-octone (PubChem CID 172844202) has the molecular formula C31H32N6O12S and a molecular weight of 712.69 g/mol. Its IUPAC name is 3-[[4-[(3-thiophen-2-ylpyrazol-1-yl)methyl]phenyl]methyl]-1,7,13,19-tetraoxa-4,10,16,22-tetrazacyclotetracosane-2,5,8,11,14,17,20,23-octone.
| Compound Name | 3-[[4-[(3-thiophen-2-ylpyrazol-1-yl)methyl]phenyl]methyl]-1,7,13,19-tetraoxa-4,10,16,22-tetrazacyclotetracosane-2,5,8,11,14,17,20,23-octone |
|---|---|
| PubChem CID | 172844202 |
| Molecular Formula | C31H32N6O12S |
| Molecular Weight | 712.69 g/mol |
| Exact Mass | 712.18 |
| IUPAC Name | 3-[[4-[(3-thiophen-2-ylpyrazol-1-yl)methyl]phenyl]methyl]-1,7,13,19-tetraoxa-4,10,16,22-tetrazacyclotetracosane-2,5,8,11,14,17,20,23-octone |
| SMILES | O=C1COC(=O)CNC(=O)COC(=O)C(Cc2ccc(Cn3ccc(-c4cccs4)n3)cc2)NC(=O)COC(=O)CNC(=O)COC(=O)CN1 |
| InChI | InChI=1S/C31H32N6O12S/c38-24-15-47-29(43)12-34-26(40)17-49-31(45)22(35-27(41)18-48-30(44)13-33-25(39)16-46-28(42)11-32-24)10-19-3-5-20(6-4-19)14-37-8-7-21(36-37)23-2-1-9-50-23/h1-9,22H,10-18H2,(H,32,38)(H,33,39)(H,34,40)(H,35,41) |
| InChIKey | XEULWTQHTXXOJC-UHFFFAOYSA-N |
| XLogP | -1.78 |
| TPSA | 239.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.69 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|