C20H22N2O5 — CID 172845372
3-[7-(3,3-diethoxyprop-1-ynyl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 172845372) has the molecular formula C20H22N2O5 and a molecular weight of 370.41 g/mol. Its IUPAC name is 3-[7-(3,3-diethoxyprop-1-ynyl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-(3,3-diethoxyprop-1-ynyl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 172845372 |
| Molecular Formula | C20H22N2O5 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 3-[7-(3,3-diethoxyprop-1-ynyl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CCOC(C#Cc1cccc2c1CN(C1CCC(=O)NC1=O)C2=O)OCC |
| InChI | InChI=1S/C20H22N2O5/c1-3-26-18(27-4-2)11-8-13-6-5-7-14-15(13)12-22(20(14)25)16-9-10-17(23)21-19(16)24/h5-7,16,18H,3-4,9-10,12H2,1-2H3,(H,21,23,24) |
| InChIKey | XIPXUCKRFHPHKU-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|