C20H23NO2 — CID 172845443
1-cyclobutyl-3,9-dimethoxy-6,7-dihydro-5H-benzo[d][2]benzazepine (PubChem CID 172845443) has the molecular formula C20H23NO2 and a molecular weight of 309.41 g/mol. Its IUPAC name is 1-cyclobutyl-3,9-dimethoxy-6,7-dihydro-5H-benzo[d][2]benzazepine.
| Compound Name | 1-cyclobutyl-3,9-dimethoxy-6,7-dihydro-5H-benzo[d][2]benzazepine |
|---|---|
| PubChem CID | 172845443 |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 1-cyclobutyl-3,9-dimethoxy-6,7-dihydro-5H-benzo[d][2]benzazepine |
| SMILES | COc1ccc2c(c1)CNCc1cc(OC)cc(C3CCC3)c1-2 |
| InChI | InChI=1S/C20H23NO2/c1-22-16-6-7-18-14(8-16)11-21-12-15-9-17(23-2)10-19(20(15)18)13-4-3-5-13/h6-10,13,21H,3-5,11-12H2,1-2H3 |
| InChIKey | XIVVMJNVXQLCEB-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |