C9H10N2O — CID 172849376
9-methyl-4H-pyrido[1,2-a]pyrimidin-2-ol (PubChem CID 172849376) has the molecular formula C9H10N2O and a molecular weight of 162.19 g/mol. Its IUPAC name is 9-methyl-4H-pyrido[1,2-a]pyrimidin-2-ol.
| Compound Name | 9-methyl-4H-pyrido[1,2-a]pyrimidin-2-ol |
|---|---|
| PubChem CID | 172849376 |
| Molecular Formula | C9H10N2O |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | 9-methyl-4H-pyrido[1,2-a]pyrimidin-2-ol |
| SMILES | CC1=CC=CN2CC=C(O)N=C12 |
| InChI | InChI=1S/C9H10N2O/c1-7-3-2-5-11-6-4-8(12)10-9(7)11/h2-5,12H,6H2,1H3 |
| InChIKey | XVYXIOIVJCLAHF-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |