C22H27N3O2S2 — CID 17285020
1-(2-hydroxy-5-methylphenyl)-3-[3-(piperidine-1-carbonyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]thiourea (PubChem CID 17285020) has the molecular formula C22H27N3O2S2 and a molecular weight of 429.61 g/mol. Its IUPAC name is 1-(2-hydroxy-5-methylphenyl)-3-[3-(piperidine-1-carbonyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]thiourea.
| Compound Name | 1-(2-hydroxy-5-methylphenyl)-3-[3-(piperidine-1-carbonyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]thiourea |
|---|---|
| PubChem CID | 17285020 |
| Molecular Formula | C22H27N3O2S2 |
| Molecular Weight | 429.61 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | 1-(2-hydroxy-5-methylphenyl)-3-[3-(piperidine-1-carbonyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]thiourea |
| SMILES | Cc1ccc(O)c(NC(=S)Nc2sc3c(c2C(=O)N2CCCCC2)CCCC3)c1 |
| InChI | InChI=1S/C22H27N3O2S2/c1-14-9-10-17(26)16(13-14)23-22(28)24-20-19(15-7-3-4-8-18(15)29-20)21(27)25-11-5-2-6-12-25/h9-10,13,26H,2-8,11-12H2,1H3,(H2,23,24,28) |
| InChIKey | JFQFYWBQESUEQO-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.61 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|